C14H17BrO4 — CID 113369782
ethyl 4-(3-bromophenoxy)-2,2-dimethyl-3-oxobutanoate (PubChem CID 113369782) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is ethyl 4-(3-bromophenoxy)-2,2-dimethyl-3-oxobutanoate.
| Compound Name | ethyl 4-(3-bromophenoxy)-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 113369782 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | ethyl 4-(3-bromophenoxy)-2,2-dimethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C14H17BrO4/c1-4-18-13(17)14(2,3)12(16)9-19-11-7-5-6-10(15)8-11/h5-8H,4,9H2,1-3H3 |
| InChIKey | QJVKDPLGYJGIJC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|