C13H17BrO2 — CID 71192794
1-(3-bromophenoxy)-4,4-dimethylpentan-2-one (PubChem CID 71192794) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-4,4-dimethylpentan-2-one.
| Compound Name | 1-(3-bromophenoxy)-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 71192794 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-(3-bromophenoxy)-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)CC(=O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrO2/c1-13(2,3)8-11(15)9-16-12-6-4-5-10(14)7-12/h4-7H,8-9H2,1-3H3 |
| InChIKey | MSYRJPQERAROEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |