C12H17BrO2 — CID 114447732
1-(3-bromophenoxy)-2,3-dimethylbutan-2-ol (PubChem CID 114447732) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114447732 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-(3-bromophenoxy)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C12H17BrO2/c1-9(2)12(3,14)8-15-11-6-4-5-10(13)7-11/h4-7,9,14H,8H2,1-3H3 |
| InChIKey | RYHOYYWTFVMUFZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |