C15H19BrO5 — CID 103974417
4-(3-bromophenoxy)-2-ethoxycarbonyl-2-ethylbutanoic acid (PubChem CID 103974417) has the molecular formula C15H19BrO5 and a molecular weight of 359.22 g/mol. Its IUPAC name is 4-(3-bromophenoxy)-2-ethoxycarbonyl-2-ethylbutanoic acid.
| Compound Name | 4-(3-bromophenoxy)-2-ethoxycarbonyl-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 103974417 |
| Molecular Formula | C15H19BrO5 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 4-(3-bromophenoxy)-2-ethoxycarbonyl-2-ethylbutanoic acid |
| SMILES | CCOC(=O)C(CC)(CCOc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C15H19BrO5/c1-3-15(13(17)18,14(19)20-4-2)8-9-21-12-7-5-6-11(16)10-12/h5-7,10H,3-4,8-9H2,1-2H3,(H,17,18) |
| InChIKey | DRPCNCHNAQFVEK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|