C21H34O4 — CID 71052726
2,3-dihydroxypropyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate (PubChem CID 71052726) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate.
| Compound Name | 2,3-dihydroxypropyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate |
|---|---|
| PubChem CID | 71052726 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 2,3-dihydroxypropyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate |
| SMILES | CC(C)C(CC(C)(C)C(C)(C)C(=O)OCC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C21H34O4/c1-15(2)18(16-10-8-7-9-11-16)12-20(3,4)21(5,6)19(24)25-14-17(23)13-22/h7-11,15,17-18,22-23H,12-14H2,1-6H3 |
| InChIKey | YPEIFBZTZZWWSU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |