C21H31NO2 — CID 143106556
prop-2-ynyl 6-amino-2,2,3,3,6-pentamethyl-5-phenylheptanoate (PubChem CID 143106556) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is prop-2-ynyl 6-amino-2,2,3,3,6-pentamethyl-5-phenylheptanoate.
| Compound Name | prop-2-ynyl 6-amino-2,2,3,3,6-pentamethyl-5-phenylheptanoate |
|---|---|
| PubChem CID | 143106556 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | prop-2-ynyl 6-amino-2,2,3,3,6-pentamethyl-5-phenylheptanoate |
| SMILES | C#CCOC(=O)C(C)(C)C(C)(C)CC(c1ccccc1)C(C)(C)N |
| InChI | InChI=1S/C21H31NO2/c1-8-14-24-18(23)20(4,5)19(2,3)15-17(21(6,7)22)16-12-10-9-11-13-16/h1,9-13,17H,14-15,22H2,2-7H3 |
| InChIKey | YIECHVZSAYGGQD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|