C19H31NO2 — CID 142295239
ethyl 2-methylprop-2-enoate;2-methyl-3-phenylhexan-2-amine (PubChem CID 142295239) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;2-methyl-3-phenylhexan-2-amine.
| Compound Name | ethyl 2-methylprop-2-enoate;2-methyl-3-phenylhexan-2-amine |
|---|---|
| PubChem CID | 142295239 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;2-methyl-3-phenylhexan-2-amine |
| SMILES | C=C(C)C(=O)OCC.CCCC(c1ccccc1)C(C)(C)N |
| InChI | InChI=1S/C13H21N.C6H10O2/c1-4-8-12(13(2,3)14)11-9-6-5-7-10-11;1-4-8-6(7)5(2)3/h5-7,9-10,12H,4,8,14H2,1-3H3;2,4H2,1,3H3 |
| InChIKey | HESGVSGCXRRNCN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|