C20H26O5 — CID 154219378
[6-hydroxy-2-(2-methylprop-2-enoyloxy)-3-phenylhexan-2-yl] 2-methylprop-2-enoate (PubChem CID 154219378) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [6-hydroxy-2-(2-methylprop-2-enoyloxy)-3-phenylhexan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [6-hydroxy-2-(2-methylprop-2-enoyloxy)-3-phenylhexan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154219378 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [6-hydroxy-2-(2-methylprop-2-enoyloxy)-3-phenylhexan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(OC(=O)C(=C)C)C(CCCO)c1ccccc1 |
| InChI | InChI=1S/C20H26O5/c1-14(2)18(22)24-20(5,25-19(23)15(3)4)17(12-9-13-21)16-10-7-6-8-11-16/h6-8,10-11,17,21H,1,3,9,12-13H2,2,4-5H3 |
| InChIKey | HFSLFAONVLVAIS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|