C18H20O9 — CID 174415420
[1-hydroxy-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate;phthalic acid (PubChem CID 174415420) has the molecular formula C18H20O9 and a molecular weight of 380.35 g/mol. Its IUPAC name is [1-hydroxy-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate;phthalic acid.
| Compound Name | [1-hydroxy-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate;phthalic acid |
|---|---|
| PubChem CID | 174415420 |
| Molecular Formula | C18H20O9 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [1-hydroxy-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate;phthalic acid |
| SMILES | C=C(C)C(=O)OC(C)(O)OC(=O)C(=C)C.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C10H14O5.C8H6O4/c1-6(2)8(11)14-10(5,13)15-9(12)7(3)4;9-7(10)5-3-1-2-4-6(5)8(11)12/h13H,1,3H2,2,4-5H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | PHVCFENDCHRCMS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|