About ethane;isocyanic acid;trityl 2-methylprop-2-enoate
ethane;isocyanic acid;trityl 2-methylprop-2-enoate (PubChem CID 174509512) has the molecular formula C26H27NO3
and a molecular weight of 401.51 g/mol. Its IUPAC name is ethane;isocyanic acid;trityl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethane;isocyanic acid;trityl 2-methylprop-2-enoate |
| PubChem CID | 174509512 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethane;isocyanic acid;trityl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.CC.N=C=O |
| InChI | InChI=1S/C23H20O2.C2H6.CHNO/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-2;2-1-3/h3-17H,1H2,2H3;1-2H3;2H |
| InChIKey | RDZLDBOPSHZXLG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze ethane;isocyanic acid;trityl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;isocyanic acid;trityl 2-methylprop-2-enoate?
The IUPAC name of ethane;isocyanic acid;trityl 2-methylprop-2-enoate (CID 174509512) is ethane;isocyanic acid;trityl 2-methylprop-2-enoate.
What is the SMILES notation for ethane;isocyanic acid;trityl 2-methylprop-2-enoate?
The canonical SMILES for ethane;isocyanic acid;trityl 2-methylprop-2-enoate is C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.CC.N=C=O.
What is the InChIKey of ethane;isocyanic acid;trityl 2-methylprop-2-enoate?
The InChIKey is RDZLDBOPSHZXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O2.C2H6.CHNO/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-2;2-1-3/h3-17H,1H2,2H3;1-2H3;2H.
What are the key properties of ethane;isocyanic acid;trityl 2-methylprop-2-enoate?
ethane;isocyanic acid;trityl 2-methylprop-2-enoate has a molecular weight of 401.51 g/mol, XLogP of 6.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;isocyanic acid;trityl 2-methylprop-2-enoate is sourced from PubChem (CID 174509512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).