C14H20O4 — CID 22590329
ethane-1,2-diol;1-phenylethyl 2-methylprop-2-enoate (PubChem CID 22590329) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is ethane-1,2-diol;1-phenylethyl 2-methylprop-2-enoate.
| Compound Name | ethane-1,2-diol;1-phenylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22590329 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | ethane-1,2-diol;1-phenylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)c1ccccc1.OCCO |
| InChI | InChI=1S/C12H14O2.C2H6O2/c1-9(2)12(13)14-10(3)11-7-5-4-6-8-11;3-1-2-4/h4-8,10H,1H2,2-3H3;3-4H,1-2H2 |
| InChIKey | LSPWEEKVCBPMDO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|