C24H28O4 — CID 161398992
2-methyl-4-phenylpent-2-enoic acid;1-phenylethyl 2-methylprop-2-enoate (PubChem CID 161398992) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-methyl-4-phenylpent-2-enoic acid;1-phenylethyl 2-methylprop-2-enoate.
| Compound Name | 2-methyl-4-phenylpent-2-enoic acid;1-phenylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161398992 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-methyl-4-phenylpent-2-enoic acid;1-phenylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)c1ccccc1.CC(=CC(C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/2C12H14O2/c1-9(2)12(13)14-10(3)11-7-5-4-6-8-11;1-9(8-10(2)12(13)14)11-6-4-3-5-7-11/h4-8,10H,1H2,2-3H3;3-9H,1-2H3,(H,13,14) |
| InChIKey | VTZGENANUSAOEM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|