About ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol
ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol (PubChem CID 158052477) has the molecular formula C26H34O3
and a molecular weight of 394.56 g/mol. Its IUPAC name is ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol.
Molecular Properties
| Compound Name | ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol |
| PubChem CID | 158052477 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol |
| SMILES | C/C(=C\C(C)c1ccccc1)CO.CCOC(=O)/C(C)=C/C(C)c1ccccc1 |
| InChI | InChI=1S/C14H18O2.C12H16O/c1-4-16-14(15)12(3)10-11(2)13-8-6-5-7-9-13;1-10(9-13)8-11(2)12-6-4-3-5-7-12/h5-11H,4H2,1-3H3;3-8,11,13H,9H2,1-2H3/b12-10+;10-8+ |
| InChIKey | FJQMBIMZGSBDHK-XQVYJDLESA-N |
| XLogP | 6.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol?
The IUPAC name of ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol (CID 158052477) is ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol.
What is the SMILES notation for ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol?
The canonical SMILES for ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol is C/C(=C\C(C)c1ccccc1)CO.CCOC(=O)/C(C)=C/C(C)c1ccccc1.
What is the InChIKey of ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol?
The InChIKey is FJQMBIMZGSBDHK-XQVYJDLESA-N. The full InChI is InChI=1S/C14H18O2.C12H16O/c1-4-16-14(15)12(3)10-11(2)13-8-6-5-7-9-13;1-10(9-13)8-11(2)12-6-4-3-5-7-12/h5-11H,4H2,1-3H3;3-8,11,13H,9H2,1-2H3/b12-10+;10-8+.
What are the key properties of ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol?
ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol has a molecular weight of 394.56 g/mol, XLogP of 6.03, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-methyl-4-phenylpent-2-enoate;(E)-2-methyl-4-phenylpent-2-en-1-ol is sourced from PubChem (CID 158052477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).