C13H15BrO4 — CID 10781606
ethyl (Z,4R,5R)-2-bromo-4,5-dihydroxy-5-phenylpent-2-enoate (PubChem CID 10781606) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is ethyl (Z,4R,5R)-2-bromo-4,5-dihydroxy-5-phenylpent-2-enoate.
| Compound Name | ethyl (Z,4R,5R)-2-bromo-4,5-dihydroxy-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 10781606 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | ethyl (Z,4R,5R)-2-bromo-4,5-dihydroxy-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C(Br)=C/[C@@H](O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H15BrO4/c1-2-18-13(17)10(14)8-11(15)12(16)9-6-4-3-5-7-9/h3-8,11-12,15-16H,2H2,1H3/b10-8-/t11-,12-/m1/s1 |
| InChIKey | XNWPKSDJFPIDJQ-NRCZCXPTSA-N |
| XLogP | 1.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|