C19H20O3 — CID 122190267
ethyl (3R,4S)-4-hydroxy-2-methylidene-3,4-diphenylbutanoate (PubChem CID 122190267) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl (3R,4S)-4-hydroxy-2-methylidene-3,4-diphenylbutanoate.
| Compound Name | ethyl (3R,4S)-4-hydroxy-2-methylidene-3,4-diphenylbutanoate |
|---|---|
| PubChem CID | 122190267 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethyl (3R,4S)-4-hydroxy-2-methylidene-3,4-diphenylbutanoate |
| SMILES | C=C(C(=O)OCC)[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H20O3/c1-3-22-19(21)14(2)17(15-10-6-4-7-11-15)18(20)16-12-8-5-9-13-16/h4-13,17-18,20H,2-3H2,1H3/t17-,18+/m0/s1 |
| InChIKey | AUNMERFQWVMSIN-ZWKOTPCHSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|