C33H32O4 — CID 175128575
1,3-dibenzhydryloxypropan-2-yl 2-methylprop-2-enoate (PubChem CID 175128575) has the molecular formula C33H32O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1,3-dibenzhydryloxypropan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1,3-dibenzhydryloxypropan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175128575 |
| Molecular Formula | C33H32O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1,3-dibenzhydryloxypropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COC(c1ccccc1)c1ccccc1)COC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32O4/c1-25(2)33(34)37-30(23-35-31(26-15-7-3-8-16-26)27-17-9-4-10-18-27)24-36-32(28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,30-32H,1,23-24H2,2H3 |
| InChIKey | BWKSHGHEQQRHCH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|