C18H19O6P — CID 141489646
1-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 141489646) has the molecular formula C18H19O6P and a molecular weight of 362.32 g/mol. Its IUPAC name is 1-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141489646 |
| Molecular Formula | C18H19O6P |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)c1ccc(OP(=O)(O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19O6P/c1-13(2)18(19)22-14(3)15-9-11-17(12-10-15)24-25(20,21)23-16-7-5-4-6-8-16/h4-12,14H,1H2,2-3H3,(H,20,21) |
| InChIKey | LMWVNPWKOLPPLO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|