C12H18O10P2 — CID 121347937
2-[hydroxy(phenoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate;phosphoric acid (PubChem CID 121347937) has the molecular formula C12H18O10P2 and a molecular weight of 384.21 g/mol. Its IUPAC name is 2-[hydroxy(phenoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate;phosphoric acid.
| Compound Name | 2-[hydroxy(phenoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate;phosphoric acid |
|---|---|
| PubChem CID | 121347937 |
| Molecular Formula | C12H18O10P2 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[hydroxy(phenoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate;phosphoric acid |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)Oc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C12H15O6P.H3O4P/c1-10(2)12(13)16-8-9-17-19(14,15)18-11-6-4-3-5-7-11;1-5(2,3)4/h3-7H,1,8-9H2,2H3,(H,14,15);(H3,1,2,3,4) |
| InChIKey | ZYGDQQXSSGEDCK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|