C20H27O8P — CID 161139051
3-[3-(2-methylprop-2-enoyloxy)propoxy-phenoxyphosphoryl]oxypropyl 2-methylprop-2-enoate (PubChem CID 161139051) has the molecular formula C20H27O8P and a molecular weight of 426.40 g/mol. Its IUPAC name is 3-[3-(2-methylprop-2-enoyloxy)propoxy-phenoxyphosphoryl]oxypropyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-(2-methylprop-2-enoyloxy)propoxy-phenoxyphosphoryl]oxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161139051 |
| Molecular Formula | C20H27O8P |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-[3-(2-methylprop-2-enoyloxy)propoxy-phenoxyphosphoryl]oxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOP(=O)(OCCCOC(=O)C(=C)C)Oc1ccccc1 |
| InChI | InChI=1S/C20H27O8P/c1-16(2)19(21)24-12-8-14-26-29(23,28-18-10-6-5-7-11-18)27-15-9-13-25-20(22)17(3)4/h5-7,10-11H,1,3,8-9,12-15H2,2,4H3 |
| InChIKey | UNELYTKIFXXFQN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|