C30H47O8P — CID 158144102
8-[8-(2-methylprop-2-enoyloxy)octoxy-phenoxyphosphoryl]oxyoctyl 2-methylprop-2-enoate (PubChem CID 158144102) has the molecular formula C30H47O8P and a molecular weight of 566.67 g/mol. Its IUPAC name is 8-[8-(2-methylprop-2-enoyloxy)octoxy-phenoxyphosphoryl]oxyoctyl 2-methylprop-2-enoate.
| Compound Name | 8-[8-(2-methylprop-2-enoyloxy)octoxy-phenoxyphosphoryl]oxyoctyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158144102 |
| Molecular Formula | C30H47O8P |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 8-[8-(2-methylprop-2-enoyloxy)octoxy-phenoxyphosphoryl]oxyoctyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCOP(=O)(OCCCCCCCCOC(=O)C(=C)C)Oc1ccccc1 |
| InChI | InChI=1S/C30H47O8P/c1-26(2)29(31)34-22-16-9-5-7-11-18-24-36-39(33,38-28-20-14-13-15-21-28)37-25-19-12-8-6-10-17-23-35-30(32)27(3)4/h13-15,20-21H,1,3,5-12,16-19,22-25H2,2,4H3 |
| InChIKey | FUHKIYHDTARJGO-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|