2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid

C13H17O8P — CID 118541677

IUPAC2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid
SMILESC=C(C)C(=O)OCCc1ccccc1C(=O)O.O=P(O)(O)O
InChIInChI=1S/C13H14O4.H3O4P/c1-9(2)13(16)17-8-7-10-5-3-4-6-11(10)12(14)15;1-5(2,3)4/h3-6H,1,7-8H2,2H3,(H,14,15);(H3,1,2,3,4)
InChIKeyHRSNTXBQCSUCQB-UHFFFAOYSA-N
MW332.25 g/mol
LogP1.12
Rot. Bonds5

About 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid

2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid (PubChem CID 118541677) has the molecular formula C13H17O8P and a molecular weight of 332.25 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid.

Molecular Properties

Compound Name2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid
PubChem CID118541677
Molecular FormulaC13H17O8P
Molecular Weight332.25 g/mol
Exact Mass332.07
IUPAC Name2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid
SMILESC=C(C)C(=O)OCCc1ccccc1C(=O)O.O=P(O)(O)O
InChIInChI=1S/C13H14O4.H3O4P/c1-9(2)13(16)17-8-7-10-5-3-4-6-11(10)12(14)15;1-5(2,3)4/h3-6H,1,7-8H2,2H3,(H,14,15);(H3,1,2,3,4)
InChIKeyHRSNTXBQCSUCQB-UHFFFAOYSA-N
XLogP1.12
TPSA141.36 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.25
LogP ≤ 51.12
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid?
The IUPAC name of 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid (CID 118541677) is 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid.
What is the SMILES notation for 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid?
The canonical SMILES for 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid is C=C(C)C(=O)OCCc1ccccc1C(=O)O.O=P(O)(O)O.
What is the InChIKey of 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid?
The InChIKey is HRSNTXBQCSUCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4.H3O4P/c1-9(2)13(16)17-8-7-10-5-3-4-6-11(10)12(14)15;1-5(2,3)4/h3-6H,1,7-8H2,2H3,(H,14,15);(H3,1,2,3,4).
What are the key properties of 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid?
2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid has a molecular weight of 332.25 g/mol, XLogP of 1.12, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid is sourced from PubChem (CID 118541677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).