C13H17O8P — CID 118541677
2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid (PubChem CID 118541677) has the molecular formula C13H17O8P and a molecular weight of 332.25 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid |
|---|---|
| PubChem CID | 118541677 |
| Molecular Formula | C13H17O8P |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethyl]benzoic acid;phosphoric acid |
| SMILES | C=C(C)C(=O)OCCc1ccccc1C(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C13H14O4.H3O4P/c1-9(2)13(16)17-8-7-10-5-3-4-6-11(10)12(14)15;1-5(2,3)4/h3-6H,1,7-8H2,2H3,(H,14,15);(H3,1,2,3,4) |
| InChIKey | HRSNTXBQCSUCQB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|