C24H26O6S — CID 67831254
2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]sulfonylphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 67831254) has the molecular formula C24H26O6S and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]sulfonylphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]sulfonylphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67831254 |
| Molecular Formula | C24H26O6S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]sulfonylphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccccc1S(=O)(=O)c1ccccc1CCOC(=O)C(=C)C |
| InChI | InChI=1S/C24H26O6S/c1-17(2)23(25)29-15-13-19-9-5-7-11-21(19)31(27,28)22-12-8-6-10-20(22)14-16-30-24(26)18(3)4/h5-12H,1,3,13-16H2,2,4H3 |
| InChIKey | DWABLTXFUHGPFV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|