About 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide
2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide (PubChem CID 172855401) has the molecular formula C12H14I2O2
and a molecular weight of 444.05 g/mol. Its IUPAC name is 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide.
Molecular Properties
| Compound Name | 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide |
| PubChem CID | 172855401 |
| Molecular Formula | C12H14I2O2 |
| Molecular Weight | 444.05 g/mol |
| Exact Mass | 443.91 |
| IUPAC Name | 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide |
| SMILES | C=C(C)C(=O)OCCc1ccccc1I.I |
| InChI | InChI=1S/C12H13IO2.HI/c1-9(2)12(14)15-8-7-10-5-3-4-6-11(10)13;/h3-6H,1,7-8H2,2H3;1H |
| InChIKey | YQDAEZKKZBEHQG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.05 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide?
The IUPAC name of 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide (CID 172855401) is 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide.
What is the SMILES notation for 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide?
The canonical SMILES for 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide is C=C(C)C(=O)OCCc1ccccc1I.I.
What is the InChIKey of 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide?
The InChIKey is YQDAEZKKZBEHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13IO2.HI/c1-9(2)12(14)15-8-7-10-5-3-4-6-11(10)13;/h3-6H,1,7-8H2,2H3;1H.
What are the key properties of 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide?
2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide has a molecular weight of 444.05 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodophenyl)ethyl 2-methylprop-2-enoate;hydroiodide is sourced from PubChem (CID 172855401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).