C42H38N3O8P3 — CID 139900698
2-[2-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139900698) has the molecular formula C42H38N3O8P3 and a molecular weight of 805.70 g/mol. Its IUPAC name is 2-[2-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139900698 |
| Molecular Formula | C42H38N3O8P3 |
| Molecular Weight | 805.70 g/mol |
| Exact Mass | 805.19 |
| IUPAC Name | 2-[2-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccccc1OP1(Oc2ccccc2)=NP(Oc2ccccc2)(Oc2ccccc2)=NP(Oc2ccccc2)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C42H38N3O8P3/c1-34(2)42(46)47-33-32-35-20-18-19-31-41(35)53-56(52-40-29-16-7-17-30-40)44-54(48-36-21-8-3-9-22-36,49-37-23-10-4-11-24-37)43-55(45-56,50-38-25-12-5-13-26-38)51-39-27-14-6-15-28-39/h3-31H,1,32-33H2,2H3 |
| InChIKey | IMGADBHEOIOHKA-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 118.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.70 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|