C18H17N3O2 — CID 154277498
2-(2-phenylbenzotriazol-4-yl)ethyl 2-methylprop-2-enoate (PubChem CID 154277498) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-(2-phenylbenzotriazol-4-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-phenylbenzotriazol-4-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154277498 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(2-phenylbenzotriazol-4-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cccc2nn(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H17N3O2/c1-13(2)18(22)23-12-11-14-7-6-10-16-17(14)20-21(19-16)15-8-4-3-5-9-15/h3-10H,1,11-12H2,2H3 |
| InChIKey | QDQSYGYRWYIDTL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|