C12H13N3O3 — CID 139707339
2-(2-hydroxybenzotriazol-5-yl)ethyl 2-methylprop-2-enoate (PubChem CID 139707339) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(2-hydroxybenzotriazol-5-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-hydroxybenzotriazol-5-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139707339 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(2-hydroxybenzotriazol-5-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc2nn(O)nc2c1 |
| InChI | InChI=1S/C12H13N3O3/c1-8(2)12(16)18-6-5-9-3-4-10-11(7-9)14-15(17)13-10/h3-4,7,17H,1,5-6H2,2H3 |
| InChIKey | YFTUYZVCNYZOHO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|