C21H21N3O5 — CID 137375984
4-[2-(6-hydroxy-1,3-benzodioxol-5-yl)benzotriazol-5-yl]butyl 2-methylprop-2-enoate (PubChem CID 137375984) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-[2-(6-hydroxy-1,3-benzodioxol-5-yl)benzotriazol-5-yl]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[2-(6-hydroxy-1,3-benzodioxol-5-yl)benzotriazol-5-yl]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137375984 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[2-(6-hydroxy-1,3-benzodioxol-5-yl)benzotriazol-5-yl]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCc1ccc2nn(-c3cc4c(cc3O)OCO4)nc2c1 |
| InChI | InChI=1S/C21H21N3O5/c1-13(2)21(26)27-8-4-3-5-14-6-7-15-16(9-14)23-24(22-15)17-10-19-20(11-18(17)25)29-12-28-19/h6-7,9-11,25H,1,3-5,8,12H2,2H3 |
| InChIKey | IUORDNFXCZKUKU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|