C12H14O2S2 — CID 129175213
2-[3,4-bis(sulfanyl)phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 129175213) has the molecular formula C12H14O2S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[3,4-bis(sulfanyl)phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3,4-bis(sulfanyl)phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129175213 |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-[3,4-bis(sulfanyl)phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(S)c(S)c1 |
| InChI | InChI=1S/C12H14O2S2/c1-8(2)12(13)14-6-5-9-3-4-10(15)11(16)7-9/h3-4,7,15-16H,1,5-6H2,2H3 |
| InChIKey | PADPDPILPYFBQU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|