C14H12O5 — CID 170165738
2-(1,3-dioxo-2-benzofuran-5-yl)ethyl 2-methylprop-2-enoate (PubChem CID 170165738) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-benzofuran-5-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(1,3-dioxo-2-benzofuran-5-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170165738 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-(1,3-dioxo-2-benzofuran-5-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C14H12O5/c1-8(2)12(15)18-6-5-9-3-4-10-11(7-9)14(17)19-13(10)16/h3-4,7H,1,5-6H2,2H3 |
| InChIKey | LGSWENDFTWJOMD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|