C17H16O8 — CID 134469721
methyl 6-[2-(2-methylprop-2-enoyloxy)ethoxymethyl]-1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 134469721) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is methyl 6-[2-(2-methylprop-2-enoyloxy)ethoxymethyl]-1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | methyl 6-[2-(2-methylprop-2-enoyloxy)ethoxymethyl]-1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 134469721 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | methyl 6-[2-(2-methylprop-2-enoyloxy)ethoxymethyl]-1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | C=C(C)C(=O)OCCOCc1cc2c(cc1C(=O)OC)C(=O)OC2=O |
| InChI | InChI=1S/C17H16O8/c1-9(2)14(18)24-5-4-23-8-10-6-12-13(17(21)25-16(12)20)7-11(10)15(19)22-3/h6-7H,1,4-5,8H2,2-3H3 |
| InChIKey | BYRBSPKICWKDGY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|