C26H22O11 — CID 152987578
2-O-[2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate (PubChem CID 152987578) has the molecular formula C26H22O11 and a molecular weight of 510.45 g/mol. Its IUPAC name is 2-O-[2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 152987578 |
| Molecular Formula | C26H22O11 |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-O-[2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccccc1C(=O)OCC(C)OC(=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C26H22O11/c1-14(2)21(27)33-10-11-34-23(29)17-6-4-5-7-18(17)24(30)35-13-15(3)36-22(28)16-8-9-19-20(12-16)26(32)37-25(19)31/h4-9,12,15H,1,10-11,13H2,2-3H3 |
| InChIKey | UVPRRARONDWDPQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|