C18H26O6 — CID 162197928
2-O-(2-hydroxypropyl) 1-O-(2-methoxyethyl) benzene-1,2-dicarboxylate;2-methylprop-1-ene (PubChem CID 162197928) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-O-(2-hydroxypropyl) 1-O-(2-methoxyethyl) benzene-1,2-dicarboxylate;2-methylprop-1-ene.
| Compound Name | 2-O-(2-hydroxypropyl) 1-O-(2-methoxyethyl) benzene-1,2-dicarboxylate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 162197928 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-O-(2-hydroxypropyl) 1-O-(2-methoxyethyl) benzene-1,2-dicarboxylate;2-methylprop-1-ene |
| SMILES | C=C(C)C.COCCOC(=O)c1ccccc1C(=O)OCC(C)O |
| InChI | InChI=1S/C14H18O6.C4H8/c1-10(15)9-20-14(17)12-6-4-3-5-11(12)13(16)19-8-7-18-2;1-4(2)3/h3-6,10,15H,7-9H2,1-2H3;1H2,2-3H3 |
| InChIKey | ZREULTQYLFOVLK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|