C25H30O8 — CID 163803485
2-O-[3-(1-cyclopentylidene-2-methylprop-2-enoxy)-2-hydroxypropyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate (PubChem CID 163803485) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-O-[3-(1-cyclopentylidene-2-methylprop-2-enoxy)-2-hydroxypropyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[3-(1-cyclopentylidene-2-methylprop-2-enoxy)-2-hydroxypropyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163803485 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-O-[3-(1-cyclopentylidene-2-methylprop-2-enoxy)-2-hydroxypropyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate |
| SMILES | C=CC(=O)OCCOC(=O)c1ccccc1C(=O)OCC(O)COC(C(=C)C)=C1CCCC1 |
| InChI | InChI=1S/C25H30O8/c1-4-22(27)30-13-14-31-24(28)20-11-7-8-12-21(20)25(29)33-16-19(26)15-32-23(17(2)3)18-9-5-6-10-18/h4,7-8,11-12,19,26H,1-2,5-6,9-10,13-16H2,3H3 |
| InChIKey | NGZJECSTIJERAC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|