C16H20O7 — CID 174969580
ethyl prop-2-enoate;2-(2-hydroxypropoxycarbonyl)benzoic acid (PubChem CID 174969580) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl prop-2-enoate;2-(2-hydroxypropoxycarbonyl)benzoic acid.
| Compound Name | ethyl prop-2-enoate;2-(2-hydroxypropoxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 174969580 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | ethyl prop-2-enoate;2-(2-hydroxypropoxycarbonyl)benzoic acid |
| SMILES | C=CC(=O)OCC.CC(O)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H12O5.C5H8O2/c1-7(12)6-16-11(15)9-5-3-2-4-8(9)10(13)14;1-3-5(6)7-4-2/h2-5,7,12H,6H2,1H3,(H,13,14);3H,1,4H2,2H3 |
| InChIKey | ARTSTZHRCMSYLB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|