C16H18O7 — CID 71391370
2-(4-hydroxy-2-prop-2-enoyloxypentoxy)carbonylbenzoic acid (PubChem CID 71391370) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-(4-hydroxy-2-prop-2-enoyloxypentoxy)carbonylbenzoic acid.
| Compound Name | 2-(4-hydroxy-2-prop-2-enoyloxypentoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 71391370 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(4-hydroxy-2-prop-2-enoyloxypentoxy)carbonylbenzoic acid |
| SMILES | C=CC(=O)OC(COC(=O)c1ccccc1C(=O)O)CC(C)O |
| InChI | InChI=1S/C16H18O7/c1-3-14(18)23-11(8-10(2)17)9-22-16(21)13-7-5-4-6-12(13)15(19)20/h3-7,10-11,17H,1,8-9H2,2H3,(H,19,20) |
| InChIKey | PAIKMJCEYRVOMT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|