C15H18O6 — CID 141409155
2-(4-hydroxy-2-prop-2-enoxybutoxy)carbonylbenzoic acid (PubChem CID 141409155) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-(4-hydroxy-2-prop-2-enoxybutoxy)carbonylbenzoic acid.
| Compound Name | 2-(4-hydroxy-2-prop-2-enoxybutoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 141409155 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(4-hydroxy-2-prop-2-enoxybutoxy)carbonylbenzoic acid |
| SMILES | C=CCOC(CCO)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C15H18O6/c1-2-9-20-11(7-8-16)10-21-15(19)13-6-4-3-5-12(13)14(17)18/h2-6,11,16H,1,7-10H2,(H,17,18) |
| InChIKey | SLJVPPAWZGAVIR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|