C14H18O7 — CID 141057144
2-[4-hydroxy-2-(2-hydroxyethoxy)butoxy]carbonylbenzoic acid (PubChem CID 141057144) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[4-hydroxy-2-(2-hydroxyethoxy)butoxy]carbonylbenzoic acid.
| Compound Name | 2-[4-hydroxy-2-(2-hydroxyethoxy)butoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 141057144 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[4-hydroxy-2-(2-hydroxyethoxy)butoxy]carbonylbenzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)OCC(CCO)OCCO |
| InChI | InChI=1S/C14H18O7/c15-6-5-10(20-8-7-16)9-21-14(19)12-4-2-1-3-11(12)13(17)18/h1-4,10,15-16H,5-9H2,(H,17,18) |
| InChIKey | HZMBDEAFYDBYPH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |