About barium(2+);2-ethoxycarbonylbenzoic acid;hydride
barium(2+);2-ethoxycarbonylbenzoic acid;hydride (PubChem CID 174858684) has the molecular formula C10H12BaO4
and a molecular weight of 333.53 g/mol. Its IUPAC name is barium(2+);2-ethoxycarbonylbenzoic acid;hydride.
Molecular Properties
| Compound Name | barium(2+);2-ethoxycarbonylbenzoic acid;hydride |
| PubChem CID | 174858684 |
| Molecular Formula | C10H12BaO4 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | barium(2+);2-ethoxycarbonylbenzoic acid;hydride |
| SMILES | CCOC(=O)c1ccccc1C(=O)O.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C10H10O4.Ba.2H/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12;;;/h3-6H,2H2,1H3,(H,11,12);;;/q;+2;2*-1 |
| InChIKey | LCXCOGDBDMTLFL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze barium(2+);2-ethoxycarbonylbenzoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-ethoxycarbonylbenzoic acid;hydride?
The IUPAC name of barium(2+);2-ethoxycarbonylbenzoic acid;hydride (CID 174858684) is barium(2+);2-ethoxycarbonylbenzoic acid;hydride.
What is the SMILES notation for barium(2+);2-ethoxycarbonylbenzoic acid;hydride?
The canonical SMILES for barium(2+);2-ethoxycarbonylbenzoic acid;hydride is CCOC(=O)c1ccccc1C(=O)O.[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);2-ethoxycarbonylbenzoic acid;hydride?
The InChIKey is LCXCOGDBDMTLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4.Ba.2H/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12;;;/h3-6H,2H2,1H3,(H,11,12);;;/q;+2;2*-1.
What are the key properties of barium(2+);2-ethoxycarbonylbenzoic acid;hydride?
barium(2+);2-ethoxycarbonylbenzoic acid;hydride has a molecular weight of 333.53 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-ethoxycarbonylbenzoic acid;hydride is sourced from PubChem (CID 174858684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).