About ethyl benzoate;phthalic acid
ethyl benzoate;phthalic acid (PubChem CID 159584831) has the molecular formula C17H16O6
and a molecular weight of 316.31 g/mol. Its IUPAC name is ethyl benzoate;phthalic acid.
Molecular Properties
| Compound Name | ethyl benzoate;phthalic acid |
| PubChem CID | 159584831 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | ethyl benzoate;phthalic acid |
| SMILES | CCOC(=O)c1ccccc1.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C9H10O2.C8H6O4/c1-2-11-9(10)8-6-4-3-5-7-8;9-7(10)5-3-1-2-4-6(5)8(11)12/h3-7H,2H2,1H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | MJMCTVLSBNOUJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl benzoate;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl benzoate;phthalic acid?
The IUPAC name of ethyl benzoate;phthalic acid (CID 159584831) is ethyl benzoate;phthalic acid.
What is the SMILES notation for ethyl benzoate;phthalic acid?
The canonical SMILES for ethyl benzoate;phthalic acid is CCOC(=O)c1ccccc1.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of ethyl benzoate;phthalic acid?
The InChIKey is MJMCTVLSBNOUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C8H6O4/c1-2-11-9(10)8-6-4-3-5-7-8;9-7(10)5-3-1-2-4-6(5)8(11)12/h3-7H,2H2,1H3;1-4H,(H,9,10)(H,11,12).
What are the key properties of ethyl benzoate;phthalic acid?
ethyl benzoate;phthalic acid has a molecular weight of 316.31 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl benzoate;phthalic acid is sourced from PubChem (CID 159584831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).