About 2-ethylbenzoic acid;ethyl 2-methylbenzoate
2-ethylbenzoic acid;ethyl 2-methylbenzoate (PubChem CID 175978347) has the molecular formula C19H22O4
and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-ethylbenzoic acid;ethyl 2-methylbenzoate.
Molecular Properties
| Compound Name | 2-ethylbenzoic acid;ethyl 2-methylbenzoate |
| PubChem CID | 175978347 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-ethylbenzoic acid;ethyl 2-methylbenzoate |
| SMILES | CCOC(=O)c1ccccc1C.CCc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H12O2.C9H10O2/c1-3-12-10(11)9-7-5-4-6-8(9)2;1-2-7-5-3-4-6-8(7)9(10)11/h4-7H,3H2,1-2H3;3-6H,2H2,1H3,(H,10,11) |
| InChIKey | DIFRIOFZOYNNHQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylbenzoic acid;ethyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbenzoic acid;ethyl 2-methylbenzoate?
The IUPAC name of 2-ethylbenzoic acid;ethyl 2-methylbenzoate (CID 175978347) is 2-ethylbenzoic acid;ethyl 2-methylbenzoate.
What is the SMILES notation for 2-ethylbenzoic acid;ethyl 2-methylbenzoate?
The canonical SMILES for 2-ethylbenzoic acid;ethyl 2-methylbenzoate is CCOC(=O)c1ccccc1C.CCc1ccccc1C(=O)O.
What is the InChIKey of 2-ethylbenzoic acid;ethyl 2-methylbenzoate?
The InChIKey is DIFRIOFZOYNNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C9H10O2/c1-3-12-10(11)9-7-5-4-6-8(9)2;1-2-7-5-3-4-6-8(7)9(10)11/h4-7H,3H2,1-2H3;3-6H,2H2,1H3,(H,10,11).
What are the key properties of 2-ethylbenzoic acid;ethyl 2-methylbenzoate?
2-ethylbenzoic acid;ethyl 2-methylbenzoate has a molecular weight of 314.38 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbenzoic acid;ethyl 2-methylbenzoate is sourced from PubChem (CID 175978347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).