About carbonic acid;ethyl 2-propylbenzoate
carbonic acid;ethyl 2-propylbenzoate (PubChem CID 174721035) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is carbonic acid;ethyl 2-propylbenzoate.
Molecular Properties
| Compound Name | carbonic acid;ethyl 2-propylbenzoate |
| PubChem CID | 174721035 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | carbonic acid;ethyl 2-propylbenzoate |
| SMILES | CCCc1ccccc1C(=O)OCC.O=C(O)O |
| InChI | InChI=1S/C12H16O2.CH2O3/c1-3-7-10-8-5-6-9-11(10)12(13)14-4-2;2-1(3)4/h5-6,8-9H,3-4,7H2,1-2H3;(H2,2,3,4) |
| InChIKey | JFBFWDJPXKDCLA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;ethyl 2-propylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;ethyl 2-propylbenzoate?
The IUPAC name of carbonic acid;ethyl 2-propylbenzoate (CID 174721035) is carbonic acid;ethyl 2-propylbenzoate.
What is the SMILES notation for carbonic acid;ethyl 2-propylbenzoate?
The canonical SMILES for carbonic acid;ethyl 2-propylbenzoate is CCCc1ccccc1C(=O)OCC.O=C(O)O.
What is the InChIKey of carbonic acid;ethyl 2-propylbenzoate?
The InChIKey is JFBFWDJPXKDCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2.CH2O3/c1-3-7-10-8-5-6-9-11(10)12(13)14-4-2;2-1(3)4/h5-6,8-9H,3-4,7H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;ethyl 2-propylbenzoate?
carbonic acid;ethyl 2-propylbenzoate has a molecular weight of 254.28 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;ethyl 2-propylbenzoate is sourced from PubChem (CID 174721035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).