About butyl 2-propylbenzoate
butyl 2-propylbenzoate (PubChem CID 20558593) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is butyl 2-propylbenzoate.
Molecular Properties
| Compound Name | butyl 2-propylbenzoate |
| PubChem CID | 20558593 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | butyl 2-propylbenzoate |
| SMILES | CCCCOC(=O)c1ccccc1CCC |
| InChI | InChI=1S/C14H20O2/c1-3-5-11-16-14(15)13-10-7-6-9-12(13)8-4-2/h6-7,9-10H,3-5,8,11H2,1-2H3 |
| InChIKey | SGLDQAZIUGTVLW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-propylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-propylbenzoate?
The IUPAC name of butyl 2-propylbenzoate (CID 20558593) is butyl 2-propylbenzoate.
What is the SMILES notation for butyl 2-propylbenzoate?
The canonical SMILES for butyl 2-propylbenzoate is CCCCOC(=O)c1ccccc1CCC.
What is the InChIKey of butyl 2-propylbenzoate?
The InChIKey is SGLDQAZIUGTVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-5-11-16-14(15)13-10-7-6-9-12(13)8-4-2/h6-7,9-10H,3-5,8,11H2,1-2H3.
What are the key properties of butyl 2-propylbenzoate?
butyl 2-propylbenzoate has a molecular weight of 220.31 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-propylbenzoate is sourced from PubChem (CID 20558593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).