C44H58O12 — CID 175367471
bis(2-O-(3-methylbutyl) 1-O-pentyl benzene-1,2-dicarboxylate);phthalic acid (PubChem CID 175367471) has the molecular formula C44H58O12 and a molecular weight of 778.94 g/mol. Its IUPAC name is bis(2-O-(3-methylbutyl) 1-O-pentyl benzene-1,2-dicarboxylate);phthalic acid.
| Compound Name | bis(2-O-(3-methylbutyl) 1-O-pentyl benzene-1,2-dicarboxylate);phthalic acid |
|---|---|
| PubChem CID | 175367471 |
| Molecular Formula | C44H58O12 |
| Molecular Weight | 778.94 g/mol |
| Exact Mass | 778.39 |
| IUPAC Name | bis(2-O-(3-methylbutyl) 1-O-pentyl benzene-1,2-dicarboxylate);phthalic acid |
| SMILES | CCCCCOC(=O)c1ccccc1C(=O)OCCC(C)C.CCCCCOC(=O)c1ccccc1C(=O)OCCC(C)C.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/2C18H26O4.C8H6O4/c2*1-4-5-8-12-21-17(19)15-9-6-7-10-16(15)18(20)22-13-11-14(2)3;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*6-7,9-10,14H,4-5,8,11-13H2,1-3H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | SLMWNRODJVZBMO-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.94 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|