C13H10O6 — CID 68549298
2-(2,3-dioxopent-4-enoxycarbonyl)benzoic acid (PubChem CID 68549298) has the molecular formula C13H10O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-(2,3-dioxopent-4-enoxycarbonyl)benzoic acid.
| Compound Name | 2-(2,3-dioxopent-4-enoxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 68549298 |
| Molecular Formula | C13H10O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(2,3-dioxopent-4-enoxycarbonyl)benzoic acid |
| SMILES | C=CC(=O)C(=O)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C13H10O6/c1-2-10(14)11(15)7-19-13(18)9-6-4-3-5-8(9)12(16)17/h2-6H,1,7H2,(H,16,17) |
| InChIKey | OHUQVGANYDIVNJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|