About ethenol;2-ethenoxycarbonylbenzoic acid
ethenol;2-ethenoxycarbonylbenzoic acid (PubChem CID 174432530) has the molecular formula C12H12O5
and a molecular weight of 236.22 g/mol. Its IUPAC name is ethenol;2-ethenoxycarbonylbenzoic acid.
Molecular Properties
| Compound Name | ethenol;2-ethenoxycarbonylbenzoic acid |
| PubChem CID | 174432530 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | ethenol;2-ethenoxycarbonylbenzoic acid |
| SMILES | C=CO.C=COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C10H8O4.C2H4O/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12;1-2-3/h2-6H,1H2,(H,11,12);2-3H,1H2 |
| InChIKey | LBFVFIUFXSQJBG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenol;2-ethenoxycarbonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;2-ethenoxycarbonylbenzoic acid?
The IUPAC name of ethenol;2-ethenoxycarbonylbenzoic acid (CID 174432530) is ethenol;2-ethenoxycarbonylbenzoic acid.
What is the SMILES notation for ethenol;2-ethenoxycarbonylbenzoic acid?
The canonical SMILES for ethenol;2-ethenoxycarbonylbenzoic acid is C=CO.C=COC(=O)c1ccccc1C(=O)O.
What is the InChIKey of ethenol;2-ethenoxycarbonylbenzoic acid?
The InChIKey is LBFVFIUFXSQJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4.C2H4O/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12;1-2-3/h2-6H,1H2,(H,11,12);2-3H,1H2.
What are the key properties of ethenol;2-ethenoxycarbonylbenzoic acid?
ethenol;2-ethenoxycarbonylbenzoic acid has a molecular weight of 236.22 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;2-ethenoxycarbonylbenzoic acid is sourced from PubChem (CID 174432530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).