C17H22O7 — CID 174541973
ethane;2-(2-hydroxy-2-methyl-1-prop-2-enoyloxypropoxy)carbonylbenzoic acid (PubChem CID 174541973) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethane;2-(2-hydroxy-2-methyl-1-prop-2-enoyloxypropoxy)carbonylbenzoic acid.
| Compound Name | ethane;2-(2-hydroxy-2-methyl-1-prop-2-enoyloxypropoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 174541973 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | ethane;2-(2-hydroxy-2-methyl-1-prop-2-enoyloxypropoxy)carbonylbenzoic acid |
| SMILES | C=CC(=O)OC(OC(=O)c1ccccc1C(=O)O)C(C)(C)O.CC |
| InChI | InChI=1S/C15H16O7.C2H6/c1-4-11(16)21-14(15(2,3)20)22-13(19)10-8-6-5-7-9(10)12(17)18;1-2/h4-8,14,20H,1H2,2-3H3,(H,17,18);1-2H3 |
| InChIKey | KTZSZAWIXUKHNU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|