C20H24O9 — CID 155301453
2-O-[2-hydroxy-3-(2-methylpropanoyloxy)propyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate (PubChem CID 155301453) has the molecular formula C20H24O9 and a molecular weight of 408.40 g/mol. Its IUPAC name is 2-O-[2-hydroxy-3-(2-methylpropanoyloxy)propyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-hydroxy-3-(2-methylpropanoyloxy)propyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155301453 |
| Molecular Formula | C20H24O9 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-O-[2-hydroxy-3-(2-methylpropanoyloxy)propyl] 1-O-(2-prop-2-enoyloxyethyl) benzene-1,2-dicarboxylate |
| SMILES | C=CC(=O)OCCOC(=O)c1ccccc1C(=O)OCC(O)COC(=O)C(C)C |
| InChI | InChI=1S/C20H24O9/c1-4-17(22)26-9-10-27-19(24)15-7-5-6-8-16(15)20(25)29-12-14(21)11-28-18(23)13(2)3/h4-8,13-14,21H,1,9-12H2,2-3H3 |
| InChIKey | PQDAWEBSJGDUJP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|