C23H26O12 — CID 134220698
5-O-(2-ethenoxyethyl) 4-O-(2-hydroxypropyl) 1-O,2-O-bis(oxiran-2-ylmethyl) benzene-1,2,4,5-tetracarboxylate (PubChem CID 134220698) has the molecular formula C23H26O12 and a molecular weight of 494.45 g/mol. Its IUPAC name is 5-O-(2-ethenoxyethyl) 4-O-(2-hydroxypropyl) 1-O,2-O-bis(oxiran-2-ylmethyl) benzene-1,2,4,5-tetracarboxylate.
| Compound Name | 5-O-(2-ethenoxyethyl) 4-O-(2-hydroxypropyl) 1-O,2-O-bis(oxiran-2-ylmethyl) benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 134220698 |
| Molecular Formula | C23H26O12 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 5-O-(2-ethenoxyethyl) 4-O-(2-hydroxypropyl) 1-O,2-O-bis(oxiran-2-ylmethyl) benzene-1,2,4,5-tetracarboxylate |
| SMILES | C=COCCOC(=O)c1cc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)cc1C(=O)OCC(C)O |
| InChI | InChI=1S/C23H26O12/c1-3-29-4-5-30-20(25)16-6-18(22(27)34-11-14-9-31-14)19(23(28)35-12-15-10-32-15)7-17(16)21(26)33-8-13(2)24/h3,6-7,13-15,24H,1,4-5,8-12H2,2H3 |
| InChIKey | NBOXORIHKHRVHP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|