C18H16O6 — CID 87282021
bis(oxiran-2-ylmethyl) naphthalene-1,8-dicarboxylate (PubChem CID 87282021) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) naphthalene-1,8-dicarboxylate.
| Compound Name | bis(oxiran-2-ylmethyl) naphthalene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 87282021 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | bis(oxiran-2-ylmethyl) naphthalene-1,8-dicarboxylate |
| SMILES | O=C(OCC1CO1)c1cccc2cccc(C(=O)OCC3CO3)c12 |
| InChI | InChI=1S/C18H16O6/c19-17(23-9-12-7-21-12)14-5-1-3-11-4-2-6-15(16(11)14)18(20)24-10-13-8-22-13/h1-6,12-13H,7-10H2 |
| InChIKey | ZXETZTDFLBQTPG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|