About [(2R)-oxiran-2-yl]methyl 2-bromobenzoate
[(2R)-oxiran-2-yl]methyl 2-bromobenzoate (PubChem CID 39733858) has the molecular formula C10H9BrO3
and a molecular weight of 257.08 g/mol. Its IUPAC name is [(2R)-oxiran-2-yl]methyl 2-bromobenzoate.
Molecular Properties
| Compound Name | [(2R)-oxiran-2-yl]methyl 2-bromobenzoate |
| PubChem CID | 39733858 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | [(2R)-oxiran-2-yl]methyl 2-bromobenzoate |
| SMILES | O=C(OC[C@H]1CO1)c1ccccc1Br |
| InChI | InChI=1S/C10H9BrO3/c11-9-4-2-1-3-8(9)10(12)14-6-7-5-13-7/h1-4,7H,5-6H2/t7-/m1/s1 |
| InChIKey | CRAVHLBMADRFSG-SSDOTTSWSA-N |
| XLogP | 2.00 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxiran-2-yl]methyl 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxiran-2-yl]methyl 2-bromobenzoate?
The IUPAC name of [(2R)-oxiran-2-yl]methyl 2-bromobenzoate (CID 39733858) is [(2R)-oxiran-2-yl]methyl 2-bromobenzoate.
What is the SMILES notation for [(2R)-oxiran-2-yl]methyl 2-bromobenzoate?
The canonical SMILES for [(2R)-oxiran-2-yl]methyl 2-bromobenzoate is O=C(OC[C@H]1CO1)c1ccccc1Br.
What is the InChIKey of [(2R)-oxiran-2-yl]methyl 2-bromobenzoate?
The InChIKey is CRAVHLBMADRFSG-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H9BrO3/c11-9-4-2-1-3-8(9)10(12)14-6-7-5-13-7/h1-4,7H,5-6H2/t7-/m1/s1.
What are the key properties of [(2R)-oxiran-2-yl]methyl 2-bromobenzoate?
[(2R)-oxiran-2-yl]methyl 2-bromobenzoate has a molecular weight of 257.08 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxiran-2-yl]methyl 2-bromobenzoate is sourced from PubChem (CID 39733858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).